C27H28F3N3O3S — CID 162557953
4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfinyl]-2-ethoxy-N'-hydroxybenzenecarboximidamide (PubChem CID 162557953) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfinyl]-2-ethoxy-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfinyl]-2-ethoxy-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 162557953 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 4-[[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]sulfinyl]-2-ethoxy-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOc1cc(S(=O)N2CC(C)(C)Cc3cc(-c4ccc(C(F)(F)F)cc4)ccc32)ccc1C(N)=NO |
| InChI | InChI=1S/C27H28F3N3O3S/c1-4-36-24-14-21(10-11-22(24)25(31)32-34)37(35)33-16-26(2,3)15-19-13-18(7-12-23(19)33)17-5-8-20(9-6-17)27(28,29)30/h5-14,34H,4,15-16H2,1-3H3,(H2,31,32) |
| InChIKey | QOIGOSCBIIQLLC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|