C22H20F3N5 — CID 143908022
3-[7-[(E)-2-pyridin-2-ylethenyl]imidazo[1,2-a]pyridin-3-yl]aniline;2,2,2-trifluoroethanamine (PubChem CID 143908022) has the molecular formula C22H20F3N5 and a molecular weight of 411.43 g/mol. Its IUPAC name is 3-[7-[(E)-2-pyridin-2-ylethenyl]imidazo[1,2-a]pyridin-3-yl]aniline;2,2,2-trifluoroethanamine.
| Compound Name | 3-[7-[(E)-2-pyridin-2-ylethenyl]imidazo[1,2-a]pyridin-3-yl]aniline;2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 143908022 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[7-[(E)-2-pyridin-2-ylethenyl]imidazo[1,2-a]pyridin-3-yl]aniline;2,2,2-trifluoroethanamine |
| SMILES | NCC(F)(F)F.Nc1cccc(-c2cnc3cc(/C=C/c4ccccn4)ccn23)c1 |
| InChI | InChI=1S/C20H16N4.C2H4F3N/c21-17-5-3-4-16(13-17)19-14-23-20-12-15(9-11-24(19)20)7-8-18-6-1-2-10-22-18;3-2(4,5)1-6/h1-14H,21H2;1,6H2/b8-7+; |
| InChIKey | VZNBLGNQLXNODC-USRGLUTNSA-N |
| XLogP | 4.66 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|