C8H9F3S — CID 143909866
(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-3-thiol (PubChem CID 143909866) has the molecular formula C8H9F3S and a molecular weight of 194.22 g/mol. Its IUPAC name is (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-3-thiol.
| Compound Name | (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-3-thiol |
|---|---|
| PubChem CID | 143909866 |
| Molecular Formula | C8H9F3S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-3-thiol |
| SMILES | C=C/C(=C\C(S)=C/C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3S/c1-3-6(8(9,10)11)5-7(12)4-2/h3-5,12H,1H2,2H3/b6-5+,7-4+ |
| InChIKey | HRKPJSFVTMSVQU-HVUXDCMCSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|