About pyrrolidine;3-(trifluoromethyl)benzenethiol
pyrrolidine;3-(trifluoromethyl)benzenethiol (PubChem CID 143909879) has the molecular formula C11H14F3NS
and a molecular weight of 249.30 g/mol. Its IUPAC name is pyrrolidine;3-(trifluoromethyl)benzenethiol.
Molecular Properties
| Compound Name | pyrrolidine;3-(trifluoromethyl)benzenethiol |
| PubChem CID | 143909879 |
| Molecular Formula | C11H14F3NS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | pyrrolidine;3-(trifluoromethyl)benzenethiol |
| SMILES | C1CCNC1.FC(F)(F)c1cccc(S)c1 |
| InChI | InChI=1S/C7H5F3S.C4H9N/c8-7(9,10)5-2-1-3-6(11)4-5;1-2-4-5-3-1/h1-4,11H;5H,1-4H2 |
| InChIKey | NWVLZTXBFNVEAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine;3-(trifluoromethyl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine;3-(trifluoromethyl)benzenethiol?
The IUPAC name of pyrrolidine;3-(trifluoromethyl)benzenethiol (CID 143909879) is pyrrolidine;3-(trifluoromethyl)benzenethiol.
What is the SMILES notation for pyrrolidine;3-(trifluoromethyl)benzenethiol?
The canonical SMILES for pyrrolidine;3-(trifluoromethyl)benzenethiol is C1CCNC1.FC(F)(F)c1cccc(S)c1.
What is the InChIKey of pyrrolidine;3-(trifluoromethyl)benzenethiol?
The InChIKey is NWVLZTXBFNVEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3S.C4H9N/c8-7(9,10)5-2-1-3-6(11)4-5;1-2-4-5-3-1/h1-4,11H;5H,1-4H2.
What are the key properties of pyrrolidine;3-(trifluoromethyl)benzenethiol?
pyrrolidine;3-(trifluoromethyl)benzenethiol has a molecular weight of 249.30 g/mol, XLogP of 3.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine;3-(trifluoromethyl)benzenethiol is sourced from PubChem (CID 143909879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).