C18H19N3O4 — CID 143910002
N-[amino-(5-formyl-3-pyridinyl)methylidene]-3,4-diethoxybenzamide (PubChem CID 143910002) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[amino-(5-formyl-3-pyridinyl)methylidene]-3,4-diethoxybenzamide.
| Compound Name | N-[amino-(5-formyl-3-pyridinyl)methylidene]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 143910002 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[amino-(5-formyl-3-pyridinyl)methylidene]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)/N=C(\N)c2cncc(C=O)c2)cc1OCC |
| InChI | InChI=1S/C18H19N3O4/c1-3-24-15-6-5-13(8-16(15)25-4-2)18(23)21-17(19)14-7-12(11-22)9-20-10-14/h5-11H,3-4H2,1-2H3,(H2,19,21,23) |
| InChIKey | XCYLYYGTCQIJPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|