C22H22N2O3 — CID 143910203
N-[amino(naphthalen-1-yl)methylidene]-3,4-diethoxybenzamide (PubChem CID 143910203) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[amino(naphthalen-1-yl)methylidene]-3,4-diethoxybenzamide.
| Compound Name | N-[amino(naphthalen-1-yl)methylidene]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 143910203 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[amino(naphthalen-1-yl)methylidene]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)/N=C(\N)c2cccc3ccccc23)cc1OCC |
| InChI | InChI=1S/C22H22N2O3/c1-3-26-19-13-12-16(14-20(19)27-4-2)22(25)24-21(23)18-11-7-9-15-8-5-6-10-17(15)18/h5-14H,3-4H2,1-2H3,(H2,23,24,25) |
| InChIKey | VCFGWCCOMJHUPY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|