C35H35N2O4+ — CID 143912611
[4-acetyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl] acetate (PubChem CID 143912611) has the molecular formula C35H35N2O4+ and a molecular weight of 547.68 g/mol. Its IUPAC name is [4-acetyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl] acetate.
| Compound Name | [4-acetyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl] acetate |
|---|---|
| PubChem CID | 143912611 |
| Molecular Formula | C35H35N2O4+ |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | [4-acetyl-2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)=O)cc1C1=c2cc3c4c(c2Oc2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| InChI | InChI=1S/C35H35N2O4/c1-20(38)22-11-12-30(40-21(2)39)27(17-22)31-28-18-23-7-3-13-36-15-5-9-25(32(23)36)34(28)41-35-26-10-6-16-37-14-4-8-24(33(26)37)19-29(31)35/h11-12,17-19H,3-10,13-16H2,1-2H3/q+1 |
| InChIKey | KRYKFQDOBYTDIR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|