C32H31ClN2O3 — CID 162309392
4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride (PubChem CID 162309392) has the molecular formula C32H31ClN2O3 and a molecular weight of 527.06 g/mol. Its IUPAC name is 4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride.
| Compound Name | 4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride |
|---|---|
| PubChem CID | 162309392 |
| Molecular Formula | C32H31ClN2O3 |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride |
| SMILES | O=C(O)c1ccc(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)cc1.[Cl-] |
| InChI | InChI=1S/C32H30N2O3.ClH/c35-32(36)20-11-9-19(10-12-20)27-25-17-21-5-1-13-33-15-3-7-23(28(21)33)30(25)37-31-24-8-4-16-34-14-2-6-22(29(24)34)18-26(27)31;/h9-12,17-18H,1-8,13-16H2;1H |
| InChIKey | XKCNXMGZJJUCNP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|