C34H36N4O2 — CID 53467155
N-(2-aminoethyl)-3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenecarboximidate (PubChem CID 53467155) has the molecular formula C34H36N4O2 and a molecular weight of 532.69 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenecarboximidate.
| Compound Name | N-(2-aminoethyl)-3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 53467155 |
| Molecular Formula | C34H36N4O2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | N-(2-aminoethyl)-3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzenecarboximidate |
| SMILES | NCC/N=C(\[O-])c1cccc(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)c1 |
| InChI | InChI=1S/C34H36N4O2/c35-12-13-36-34(39)24-7-1-6-21(18-24)29-27-19-22-8-2-14-37-16-4-10-25(30(22)37)32(27)40-33-26-11-5-17-38-15-3-9-23(31(26)38)20-28(29)33/h1,6-7,18-20H,2-5,8-17,35H2 |
| InChIKey | LHRDSJHVMJJXIQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|