C40H38F3N3O3 — CID 162307931
5-methyl-2-[4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]aniline;2,2,2-trifluoroacetate (PubChem CID 162307931) has the molecular formula C40H38F3N3O3 and a molecular weight of 665.76 g/mol. Its IUPAC name is 5-methyl-2-[4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]aniline;2,2,2-trifluoroacetate.
| Compound Name | 5-methyl-2-[4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]aniline;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162307931 |
| Molecular Formula | C40H38F3N3O3 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 5-methyl-2-[4-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]aniline;2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(-c2ccc(C3=c4cc5c6c(c4Oc4c3cc3c7c4CCCN7CCC3)CCC[N+]=6CCC5)cc2)c(N)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C38H37N3O.C2HF3O2/c1-23-10-15-28(33(39)20-23)24-11-13-25(14-12-24)34-31-21-26-6-2-16-40-18-4-8-29(35(26)40)37(31)42-38-30-9-5-19-41-17-3-7-27(36(30)41)22-32(34)38;3-2(4,5)1(6)7/h10-15,20-22,39H,2-9,16-19H2,1H3;(H,6,7) |
| InChIKey | LBEIMHCIYIPGFK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|