C35H37N2O3+ — CID 153385246
2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)-4-propan-2-ylbenzoic acid (PubChem CID 153385246) has the molecular formula C35H37N2O3+ and a molecular weight of 533.69 g/mol. Its IUPAC name is 2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)-4-propan-2-ylbenzoic acid.
| Compound Name | 2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)-4-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 153385246 |
| Molecular Formula | C35H37N2O3+ |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)-4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)c(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)c1 |
| InChI | InChI=1S/C35H36N2O3/c1-20(2)21-11-12-24(35(38)39)27(17-21)30-28-18-22-7-3-13-36-15-5-9-25(31(22)36)33(28)40-34-26-10-6-16-37-14-4-8-23(32(26)37)19-29(30)34/h11-12,17-20H,3-10,13-16H2,1-2H3/p+1 |
| InChIKey | MXAOEHZUPYOJPD-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|