C18H29FN2O — CID 143916067
ethylcyclopropane;4-fluoro-N-[2-methyl-4-(methylamino)butyl]benzamide (PubChem CID 143916067) has the molecular formula C18H29FN2O and a molecular weight of 308.44 g/mol. Its IUPAC name is ethylcyclopropane;4-fluoro-N-[2-methyl-4-(methylamino)butyl]benzamide.
| Compound Name | ethylcyclopropane;4-fluoro-N-[2-methyl-4-(methylamino)butyl]benzamide |
|---|---|
| PubChem CID | 143916067 |
| Molecular Formula | C18H29FN2O |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | ethylcyclopropane;4-fluoro-N-[2-methyl-4-(methylamino)butyl]benzamide |
| SMILES | CCC1CC1.CNCCC(C)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2O.C5H10/c1-10(7-8-15-2)9-16-13(17)11-3-5-12(14)6-4-11;1-2-5-3-4-5/h3-6,10,15H,7-9H2,1-2H3,(H,16,17);5H,2-4H2,1H3 |
| InChIKey | FTGDXOVNUJEOFR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |