C13H9BrF2N2O3 — CID 143916985
5-[(Z)-2-bromo-2-hydroxyethenyl]-1-[(3,4-difluorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 143916985) has the molecular formula C13H9BrF2N2O3 and a molecular weight of 359.13 g/mol. Its IUPAC name is 5-[(Z)-2-bromo-2-hydroxyethenyl]-1-[(3,4-difluorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-[(Z)-2-bromo-2-hydroxyethenyl]-1-[(3,4-difluorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143916985 |
| Molecular Formula | C13H9BrF2N2O3 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 5-[(Z)-2-bromo-2-hydroxyethenyl]-1-[(3,4-difluorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)c(F)c2)cc1/C=C(/O)Br |
| InChI | InChI=1S/C13H9BrF2N2O3/c14-11(19)4-8-6-18(13(21)17-12(8)20)5-7-1-2-9(15)10(16)3-7/h1-4,6,19H,5H2,(H,17,20,21)/b11-4+ |
| InChIKey | YFXGCLYNRXLKRL-NYYWCZLTSA-N |
| XLogP | 2.11 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|