C35H46O2 — CID 143917604
9-benzhydryloxy-1-(4-tert-butylphenyl)dodecan-1-one (PubChem CID 143917604) has the molecular formula C35H46O2 and a molecular weight of 498.75 g/mol. Its IUPAC name is 9-benzhydryloxy-1-(4-tert-butylphenyl)dodecan-1-one.
| Compound Name | 9-benzhydryloxy-1-(4-tert-butylphenyl)dodecan-1-one |
|---|---|
| PubChem CID | 143917604 |
| Molecular Formula | C35H46O2 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | 9-benzhydryloxy-1-(4-tert-butylphenyl)dodecan-1-one |
| SMILES | CCCC(CCCCCCCC(=O)c1ccc(C(C)(C)C)cc1)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H46O2/c1-5-17-32(37-34(29-18-11-9-12-19-29)30-20-13-10-14-21-30)22-15-7-6-8-16-23-33(36)28-24-26-31(27-25-28)35(2,3)4/h9-14,18-21,24-27,32,34H,5-8,15-17,22-23H2,1-4H3 |
| InChIKey | USMFKQYGGUCGDX-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|