C12H15BrO3S — CID 143918560
ethyl 3-(5-bromo-2-formylthiophen-3-yl)-2,2-dimethylpropanoate (PubChem CID 143918560) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is ethyl 3-(5-bromo-2-formylthiophen-3-yl)-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-(5-bromo-2-formylthiophen-3-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143918560 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | ethyl 3-(5-bromo-2-formylthiophen-3-yl)-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Cc1cc(Br)sc1C=O |
| InChI | InChI=1S/C12H15BrO3S/c1-4-16-11(15)12(2,3)6-8-5-10(13)17-9(8)7-14/h5,7H,4,6H2,1-3H3 |
| InChIKey | MKQXQZJMCJOHRF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|