C41H50N6O6 — CID 143920011
tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate;methanol;(Z)-pent-2-ene (PubChem CID 143920011) has the molecular formula C41H50N6O6 and a molecular weight of 722.89 g/mol. Its IUPAC name is tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate;methanol;(Z)-pent-2-ene.
| Compound Name | tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate;methanol;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 143920011 |
| Molecular Formula | C41H50N6O6 |
| Molecular Weight | 722.89 g/mol |
| Exact Mass | 722.38 |
| IUPAC Name | tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate;methanol;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.CC(C)(C)OC(=O)n1cc(C(=O)C#CCCCN2C(=O)c3ccccc3C2=O)c2cc(-c3cnn(CCN4CCCC4)c3)cnc21.CO |
| InChI | InChI=1S/C35H36N6O5.C5H10.CH4O/c1-35(2,3)46-34(45)41-23-29(30(42)13-5-4-8-16-40-32(43)26-11-6-7-12-27(26)33(40)44)28-19-24(20-36-31(28)41)25-21-37-39(22-25)18-17-38-14-9-10-15-38;1-3-5-4-2;1-2/h6-7,11-12,19-23H,4,8-10,14-18H2,1-3H3;3,5H,4H2,1-2H3;2H,1H3/b;5-3-; |
| InChIKey | ZTQYPLKHBUTFKT-FMFSYIAASA-N |
| XLogP | 6.62 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|