C14H21NO4 — CID 143920387
(2E)-4-methoxy-2-[1-(2-morpholin-4-ylethoxy)ethenyl]penta-2,4-dienal (PubChem CID 143920387) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (2E)-4-methoxy-2-[1-(2-morpholin-4-ylethoxy)ethenyl]penta-2,4-dienal.
| Compound Name | (2E)-4-methoxy-2-[1-(2-morpholin-4-ylethoxy)ethenyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 143920387 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (2E)-4-methoxy-2-[1-(2-morpholin-4-ylethoxy)ethenyl]penta-2,4-dienal |
| SMILES | C=C(/C=C(/C=O)C(=C)OCCN1CCOCC1)OC |
| InChI | InChI=1S/C14H21NO4/c1-12(17-3)10-14(11-16)13(2)19-9-6-15-4-7-18-8-5-15/h10-11H,1-2,4-9H2,3H3/b14-10- |
| InChIKey | LYEWGCOQBKJWAO-UVTDQMKNSA-N |
| XLogP | 1.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|