C15H16FN5OS — CID 143921827
7-[(2S,3S,5R)-5-ethyl-3-fluorooxolan-2-yl]-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 143921827) has the molecular formula C15H16FN5OS and a molecular weight of 333.39 g/mol. Its IUPAC name is 7-[(2S,3S,5R)-5-ethyl-3-fluorooxolan-2-yl]-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3S,5R)-5-ethyl-3-fluorooxolan-2-yl]-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 143921827 |
| Molecular Formula | C15H16FN5OS |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 7-[(2S,3S,5R)-5-ethyl-3-fluorooxolan-2-yl]-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC[C@@H]1C[C@H](F)[C@H](c2cc(-c3nccs3)c3c(N)ncnn23)O1 |
| InChI | InChI=1S/C15H16FN5OS/c1-2-8-5-10(16)13(22-8)11-6-9(15-18-3-4-23-15)12-14(17)19-7-20-21(11)12/h3-4,6-8,10,13H,2,5H2,1H3,(H2,17,19,20)/t8-,10+,13-/m1/s1 |
| InChIKey | RAVKHZKRJXMBCD-DFAYQTQMSA-N |
| XLogP | 3.01 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |