C20H25N — CID 143924448
(1Z,4E,6E,8Z)-N-(1-cyclopenta-1,3-dien-1-ylethenyl)-N,6-dimethyl-3-methylidenedeca-1,4,6,8-tetraen-1-amine (PubChem CID 143924448) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is (1Z,4E,6E,8Z)-N-(1-cyclopenta-1,3-dien-1-ylethenyl)-N,6-dimethyl-3-methylidenedeca-1,4,6,8-tetraen-1-amine.
| Compound Name | (1Z,4E,6E,8Z)-N-(1-cyclopenta-1,3-dien-1-ylethenyl)-N,6-dimethyl-3-methylidenedeca-1,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 143924448 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (1Z,4E,6E,8Z)-N-(1-cyclopenta-1,3-dien-1-ylethenyl)-N,6-dimethyl-3-methylidenedeca-1,4,6,8-tetraen-1-amine |
| SMILES | C=C(/C=C\N(C)C(=C)C1=CC=CC1)/C=C/C(C)=C/C=C\C |
| InChI | InChI=1S/C20H25N/c1-6-7-10-17(2)13-14-18(3)15-16-21(5)19(4)20-11-8-9-12-20/h6-11,13-16H,3-4,12H2,1-2,5H3/b7-6-,14-13+,16-15-,17-10+ |
| InChIKey | FHALARNHBQPQMH-QIRLTFKWSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|