C11H11BrN2O3 — CID 143926912
N-[[(E)-3-(4-bromo-2-methoxyphenyl)prop-2-enoyl]amino]formamide (PubChem CID 143926912) has the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. Its IUPAC name is N-[[(E)-3-(4-bromo-2-methoxyphenyl)prop-2-enoyl]amino]formamide.
| Compound Name | N-[[(E)-3-(4-bromo-2-methoxyphenyl)prop-2-enoyl]amino]formamide |
|---|---|
| PubChem CID | 143926912 |
| Molecular Formula | C11H11BrN2O3 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-[[(E)-3-(4-bromo-2-methoxyphenyl)prop-2-enoyl]amino]formamide |
| SMILES | COc1cc(Br)ccc1/C=C/C(=O)NNC=O |
| InChI | InChI=1S/C11H11BrN2O3/c1-17-10-6-9(12)4-2-8(10)3-5-11(16)14-13-7-15/h2-7H,1H3,(H,13,15)(H,14,16)/b5-3+ |
| InChIKey | LPPHZEKBLIXIMN-HWKANZROSA-N |
| XLogP | 1.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|