C14H22F4O2S — CID 143927090
(5,5,6,6-tetrafluoro-6-methylsulfanylhexyl) cyclohexanecarboxylate (PubChem CID 143927090) has the molecular formula C14H22F4O2S and a molecular weight of 330.39 g/mol. Its IUPAC name is (5,5,6,6-tetrafluoro-6-methylsulfanylhexyl) cyclohexanecarboxylate.
| Compound Name | (5,5,6,6-tetrafluoro-6-methylsulfanylhexyl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 143927090 |
| Molecular Formula | C14H22F4O2S |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (5,5,6,6-tetrafluoro-6-methylsulfanylhexyl) cyclohexanecarboxylate |
| SMILES | CSC(F)(F)C(F)(F)CCCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H22F4O2S/c1-21-14(17,18)13(15,16)9-5-6-10-20-12(19)11-7-3-2-4-8-11/h11H,2-10H2,1H3 |
| InChIKey | YQQOMFUBDJYKCY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|