C21H32N4O4S2 — CID 143928868
S-[(E,5S)-5-methyl-7-[[4-[[methyl-[(2R)-1-oxo-1-(2-oxopropylamino)propan-2-yl]amino]methyl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] methanethioate (PubChem CID 143928868) has the molecular formula C21H32N4O4S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is S-[(E,5S)-5-methyl-7-[[4-[[methyl-[(2R)-1-oxo-1-(2-oxopropylamino)propan-2-yl]amino]methyl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] methanethioate.
| Compound Name | S-[(E,5S)-5-methyl-7-[[4-[[methyl-[(2R)-1-oxo-1-(2-oxopropylamino)propan-2-yl]amino]methyl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] methanethioate |
|---|---|
| PubChem CID | 143928868 |
| Molecular Formula | C21H32N4O4S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | S-[(E,5S)-5-methyl-7-[[4-[[methyl-[(2R)-1-oxo-1-(2-oxopropylamino)propan-2-yl]amino]methyl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] methanethioate |
| SMILES | CC(=O)CNC(=O)[C@@H](C)N(C)Cc1csc(CNC(=O)C[C@H](C)/C=C/CCSC=O)n1 |
| InChI | InChI=1S/C21H32N4O4S2/c1-15(7-5-6-8-30-14-26)9-19(28)22-11-20-24-18(13-31-20)12-25(4)17(3)21(29)23-10-16(2)27/h5,7,13-15,17H,6,8-12H2,1-4H3,(H,22,28)(H,23,29)/b7-5+/t15-,17-/m1/s1 |
| InChIKey | ZHGJUEKSOCABBF-NDOICKTLSA-N |
| XLogP | 2.18 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|