C30H46N4O6S2 — CID 147321707
(2S)-3-methyl-2-[[1-[[2-[[[(E,3S)-3-methyl-7-octanoylsulfanylhept-4-enoyl]amino]methyl]-1,3-thiazole-4-carbonyl]amino]cyclopropanecarbonyl]amino]butanoic acid (PubChem CID 147321707) has the molecular formula C30H46N4O6S2 and a molecular weight of 622.85 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[1-[[2-[[[(E,3S)-3-methyl-7-octanoylsulfanylhept-4-enoyl]amino]methyl]-1,3-thiazole-4-carbonyl]amino]cyclopropanecarbonyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[1-[[2-[[[(E,3S)-3-methyl-7-octanoylsulfanylhept-4-enoyl]amino]methyl]-1,3-thiazole-4-carbonyl]amino]cyclopropanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 147321707 |
| Molecular Formula | C30H46N4O6S2 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (2S)-3-methyl-2-[[1-[[2-[[[(E,3S)-3-methyl-7-octanoylsulfanylhept-4-enoyl]amino]methyl]-1,3-thiazole-4-carbonyl]amino]cyclopropanecarbonyl]amino]butanoic acid |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H](C)CC(=O)NCc1nc(C(=O)NC2(C(=O)N[C@H](C(=O)O)C(C)C)CC2)cs1 |
| InChI | InChI=1S/C30H46N4O6S2/c1-5-6-7-8-9-13-25(36)41-16-11-10-12-21(4)17-23(35)31-18-24-32-22(19-42-24)27(37)34-30(14-15-30)29(40)33-26(20(2)3)28(38)39/h10,12,19-21,26H,5-9,11,13-18H2,1-4H3,(H,31,35)(H,33,40)(H,34,37)(H,38,39)/b12-10+/t21-,26+/m1/s1 |
| InChIKey | CZXVMHACUITVJM-FOVHPINOSA-N |
| XLogP | 4.84 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|