C25H35N3O4S3 — CID 71467495
[(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carbonyl]amino]butanoate (PubChem CID 71467495) has the molecular formula C25H35N3O4S3 and a molecular weight of 537.77 g/mol. Its IUPAC name is [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carbonyl]amino]butanoate.
| Compound Name | [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 71467495 |
| Molecular Formula | C25H35N3O4S3 |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carbonyl]amino]butanoate |
| SMILES | CCCCCCCC(=O)SCC/C=C/COC(=O)[C@@H](NC(=O)c1csc(-c2cscn2)n1)C(C)C |
| InChI | InChI=1S/C25H35N3O4S3/c1-4-5-6-7-9-12-21(29)34-14-11-8-10-13-32-25(31)22(18(2)3)28-23(30)19-16-35-24(27-19)20-15-33-17-26-20/h8,10,15-18,22H,4-7,9,11-14H2,1-3H3,(H,28,30)/b10-8+/t22-/m0/s1 |
| InChIKey | JRYBLKCUTITQED-RCHCNPRSSA-N |
| XLogP | 6.13 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|