C31H48N4O4S3 — CID 145152517
S-[(E,5S)-5-methyl-7-[[4-[4-methyl-4-[(2-methyl-4-oxopentan-3-yl)carbamoyl]-5H-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] octanethioate (PubChem CID 145152517) has the molecular formula C31H48N4O4S3 and a molecular weight of 636.95 g/mol. Its IUPAC name is S-[(E,5S)-5-methyl-7-[[4-[4-methyl-4-[(2-methyl-4-oxopentan-3-yl)carbamoyl]-5H-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] octanethioate.
| Compound Name | S-[(E,5S)-5-methyl-7-[[4-[4-methyl-4-[(2-methyl-4-oxopentan-3-yl)carbamoyl]-5H-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] octanethioate |
|---|---|
| PubChem CID | 145152517 |
| Molecular Formula | C31H48N4O4S3 |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | S-[(E,5S)-5-methyl-7-[[4-[4-methyl-4-[(2-methyl-4-oxopentan-3-yl)carbamoyl]-5H-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methylamino]-7-oxohept-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H](C)CC(=O)NCc1nc(C2=NC(C)(C(=O)NC(C(C)=O)C(C)C)CS2)cs1 |
| InChI | InChI=1S/C31H48N4O4S3/c1-7-8-9-10-11-15-27(38)40-16-13-12-14-22(4)17-25(37)32-18-26-33-24(19-41-26)29-35-31(6,20-42-29)30(39)34-28(21(2)3)23(5)36/h12,14,19,21-22,28H,7-11,13,15-18,20H2,1-6H3,(H,32,37)(H,34,39)/b14-12+/t22-,28?,31?/m1/s1 |
| InChIKey | UJMGVJKVDJWTDX-YLJXSEPGSA-N |
| XLogP | 6.33 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|