C10H16N2 — CID 143929296
ethane;2-methyl-5,6-dihydro-1H-benzimidazole (PubChem CID 143929296) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;2-methyl-5,6-dihydro-1H-benzimidazole.
| Compound Name | ethane;2-methyl-5,6-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 143929296 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethane;2-methyl-5,6-dihydro-1H-benzimidazole |
| SMILES | CC.Cc1nc2c([nH]1)=CCCC=2 |
| InChI | InChI=1S/C8H10N2.C2H6/c1-6-9-7-4-2-3-5-8(7)10-6;1-2/h4-5H,2-3H2,1H3,(H,9,10);1-2H3 |
| InChIKey | NKCPVYCDQNBMAT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |