C12H16N2 — CID 143930914
(2E)-2-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methylidene]but-3-enenitrile (PubChem CID 143930914) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2E)-2-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methylidene]but-3-enenitrile.
| Compound Name | (2E)-2-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methylidene]but-3-enenitrile |
|---|---|
| PubChem CID | 143930914 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2E)-2-[(1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methylidene]but-3-enenitrile |
| SMILES | C=C/C(C#N)=C\C1=C(C)CCN(C)C1 |
| InChI | InChI=1S/C12H16N2/c1-4-11(8-13)7-12-9-14(3)6-5-10(12)2/h4,7H,1,5-6,9H2,2-3H3/b11-7+ |
| InChIKey | STWYAYJUBUOKGZ-YRNVUSSQSA-N |
| XLogP | 2.27 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|