C29H33BrFN3O6 — CID 143931642
8-bromo-3-[ethoxy(hydroxy)methyl]-1-ethyl-7-[(3Z,5E)-5-fluoroocta-3,5-dienyl]-4-hydroxy-3,4-dihydro-1,5-naphthyridin-2-one;isoindole-1,3-dione (PubChem CID 143931642) has the molecular formula C29H33BrFN3O6 and a molecular weight of 618.50 g/mol. Its IUPAC name is 8-bromo-3-[ethoxy(hydroxy)methyl]-1-ethyl-7-[(3Z,5E)-5-fluoroocta-3,5-dienyl]-4-hydroxy-3,4-dihydro-1,5-naphthyridin-2-one;isoindole-1,3-dione.
| Compound Name | 8-bromo-3-[ethoxy(hydroxy)methyl]-1-ethyl-7-[(3Z,5E)-5-fluoroocta-3,5-dienyl]-4-hydroxy-3,4-dihydro-1,5-naphthyridin-2-one;isoindole-1,3-dione |
|---|---|
| PubChem CID | 143931642 |
| Molecular Formula | C29H33BrFN3O6 |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 8-bromo-3-[ethoxy(hydroxy)methyl]-1-ethyl-7-[(3Z,5E)-5-fluoroocta-3,5-dienyl]-4-hydroxy-3,4-dihydro-1,5-naphthyridin-2-one;isoindole-1,3-dione |
| SMILES | CC/C=C(F)\C=C/CCc1cnc2c(c1Br)N(CC)C(=O)C(C(O)OCC)C2O.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H28BrFN2O4.C8H5NO2/c1-4-9-14(23)11-8-7-10-13-12-24-17-18(16(13)22)25(5-2)20(27)15(19(17)26)21(28)29-6-3;10-7-5-3-1-2-4-6(5)8(11)9-7/h8-9,11-12,15,19,21,26,28H,4-7,10H2,1-3H3;1-4H,(H,9,10,11)/b11-8-,14-9+; |
| InChIKey | RQUPDRBWQVNKNY-SLYOQZNYSA-N |
| XLogP | 4.54 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|