About 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine
2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine (PubChem CID 143931900) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine.
Analyze 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine?
The IUPAC name of 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine (CID 143931900) is 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine.
What is the SMILES notation for 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine?
The canonical SMILES for 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine is CNCCN1C=NC(C)C=C1C.
What is the InChIKey of 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine?
The InChIKey is HGSVCHVUJSCHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-8-6-9(2)12(7-11-8)5-4-10-3/h6-8,10H,4-5H2,1-3H3.
What are the key properties of 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine?
2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine has a molecular weight of 167.26 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-4H-pyrimidin-1-yl)-N-methylethanamine is sourced from PubChem (CID 143931900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).