C28H29FN2O5 — CID 143931981
6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carbaldehyde;methoxyethane (PubChem CID 143931981) has the molecular formula C28H29FN2O5 and a molecular weight of 492.55 g/mol. Its IUPAC name is 6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carbaldehyde;methoxyethane.
| Compound Name | 6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 143931981 |
| Molecular Formula | C28H29FN2O5 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carbaldehyde;methoxyethane |
| SMILES | CCOC.O=Cc1c(OCc2ccccc2)c2ncc(CC3C=CC(F)=CC3)c3c2n(c1=O)CCO3 |
| InChI | InChI=1S/C25H21FN2O4.C3H8O/c26-19-8-6-16(7-9-19)12-18-13-27-21-22-23(18)31-11-10-28(22)25(30)20(14-29)24(21)32-15-17-4-2-1-3-5-17;1-3-4-2/h1-6,8-9,13-14,16H,7,10-12,15H2;3H2,1-2H3 |
| InChIKey | YIAVNIMLSDHIHI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|