C63H70N2 — CID 143938223
7-N,7-N,17-N,17-N-tetrakis(3,4-diethylphenyl)-12,12-dimethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,20-nonaene-7,17-diamine (PubChem CID 143938223) has the molecular formula C63H70N2 and a molecular weight of 855.27 g/mol. Its IUPAC name is 7-N,7-N,17-N,17-N-tetrakis(3,4-diethylphenyl)-12,12-dimethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,20-nonaene-7,17-diamine.
| Compound Name | 7-N,7-N,17-N,17-N-tetrakis(3,4-diethylphenyl)-12,12-dimethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,20-nonaene-7,17-diamine |
|---|---|
| PubChem CID | 143938223 |
| Molecular Formula | C63H70N2 |
| Molecular Weight | 855.27 g/mol |
| Exact Mass | 854.55 |
| IUPAC Name | 7-N,7-N,17-N,17-N-tetrakis(3,4-diethylphenyl)-12,12-dimethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,20-nonaene-7,17-diamine |
| SMILES | CCc1ccc(N(C2=Cc3cc4c(cc3CC2)-c2cc3ccc(N(c5ccc(CC)c(CC)c5)c5ccc(CC)c(CC)c5)cc3cc2C4(C)C)c2ccc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C63H70N2/c1-11-41-19-25-53(31-45(41)15-5)64(54-26-20-42(12-2)46(16-6)32-54)57-29-23-49-37-59-60-38-50-24-30-58(36-52(50)40-62(60)63(9,10)61(59)39-51(49)35-57)65(55-27-21-43(13-3)47(17-7)33-55)56-28-22-44(14-4)48(18-8)34-56/h19-23,25-29,31-40H,11-18,24,30H2,1-10H3 |
| InChIKey | RCRDBFRASLJJQB-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.27 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |