C28H36B2N2O3 — CID 143940897
2-[[4-[4-[cyclohepta-1,3-dien-5-yn-1-yl-[2-(dimethylamino)ethoxy]boranyl]phenoxy]phenyl]-methylboranyl]oxy-N,N-dimethylethanamine (PubChem CID 143940897) has the molecular formula C28H36B2N2O3 and a molecular weight of 470.23 g/mol. Its IUPAC name is 2-[[4-[4-[cyclohepta-1,3-dien-5-yn-1-yl-[2-(dimethylamino)ethoxy]boranyl]phenoxy]phenyl]-methylboranyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[[4-[4-[cyclohepta-1,3-dien-5-yn-1-yl-[2-(dimethylamino)ethoxy]boranyl]phenoxy]phenyl]-methylboranyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 143940897 |
| Molecular Formula | C28H36B2N2O3 |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-[[4-[4-[cyclohepta-1,3-dien-5-yn-1-yl-[2-(dimethylamino)ethoxy]boranyl]phenoxy]phenyl]-methylboranyl]oxy-N,N-dimethylethanamine |
| SMILES | CB(OCCN(C)C)c1ccc(Oc2ccc(B(OCCN(C)C)C3=CC=CC#CC3)cc2)cc1 |
| InChI | InChI=1S/C28H36B2N2O3/c1-29(33-22-20-31(2)3)24-12-16-27(17-13-24)35-28-18-14-26(15-19-28)30(34-23-21-32(4)5)25-10-8-6-7-9-11-25/h6,8,10,12-19H,11,20-23H2,1-5H3 |
| InChIKey | OEBMYOQHWVSIGP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|