C30H28O3 — CID 143943828
[6,6-bis(4-methoxyphenyl)-10-methyl-5H-phenanthren-9-yl]methanol (PubChem CID 143943828) has the molecular formula C30H28O3 and a molecular weight of 436.55 g/mol. Its IUPAC name is [6,6-bis(4-methoxyphenyl)-10-methyl-5H-phenanthren-9-yl]methanol.
| Compound Name | [6,6-bis(4-methoxyphenyl)-10-methyl-5H-phenanthren-9-yl]methanol |
|---|---|
| PubChem CID | 143943828 |
| Molecular Formula | C30H28O3 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [6,6-bis(4-methoxyphenyl)-10-methyl-5H-phenanthren-9-yl]methanol |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(CO)c(C)c4ccccc4c3C2)cc1 |
| InChI | InChI=1S/C30H28O3/c1-20-25-6-4-5-7-26(25)28-18-30(17-16-27(28)29(20)19-31,21-8-12-23(32-2)13-9-21)22-10-14-24(33-3)15-11-22/h4-17,31H,18-19H2,1-3H3 |
| InChIKey | JZNMJAOGIVGQPO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |