C7H16NO2S+ — CID 143944755
4-(dimethoxymethyl)-2-methyl-1,3-thiazolidin-3-ium (PubChem CID 143944755) has the molecular formula C7H16NO2S+ and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-methyl-1,3-thiazolidin-3-ium.
| Compound Name | 4-(dimethoxymethyl)-2-methyl-1,3-thiazolidin-3-ium |
|---|---|
| PubChem CID | 143944755 |
| Molecular Formula | C7H16NO2S+ |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-(dimethoxymethyl)-2-methyl-1,3-thiazolidin-3-ium |
| SMILES | COC(OC)C1CSC(C)[NH2+]1 |
| InChI | InChI=1S/C7H15NO2S/c1-5-8-6(4-11-5)7(9-2)10-3/h5-8H,4H2,1-3H3/p+1 |
| InChIKey | JZQVKXXVSCJMLD-UHFFFAOYSA-O |
| XLogP | -0.37 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|