About ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate
ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate (PubChem CID 143946121) has the molecular formula C14H22N4S
and a molecular weight of 278.43 g/mol. Its IUPAC name is ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate.
Molecular Properties
| Compound Name | ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate |
| PubChem CID | 143946121 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate |
| SMILES | CC.[H]/N=C(/Sc1ccncc1)C(=C(C)C)/C(N)=N/C |
| InChI | InChI=1S/C12H16N4S.C2H6/c1-8(2)10(11(13)15-3)12(14)17-9-4-6-16-7-5-9;1-2/h4-7,14H,1-3H3,(H2,13,15);1-2H3/b14-12+; |
| InChIKey | XUVQPNPGOWUJPD-UNGNXWFZSA-N |
| XLogP | 3.50 |
| TPSA | 75.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate?
The IUPAC name of ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate (CID 143946121) is ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate.
What is the SMILES notation for ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate?
The canonical SMILES for ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate is CC.[H]/N=C(/Sc1ccncc1)C(=C(C)C)/C(N)=N/C.
What is the InChIKey of ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate?
The InChIKey is XUVQPNPGOWUJPD-UNGNXWFZSA-N. The full InChI is InChI=1S/C12H16N4S.C2H6/c1-8(2)10(11(13)15-3)12(14)17-9-4-6-16-7-5-9;1-2/h4-7,14H,1-3H3,(H2,13,15);1-2H3/b14-12+;.
What are the key properties of ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate?
ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate has a molecular weight of 278.43 g/mol, XLogP of 3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pyridin-4-yl 3-methyl-2-(N'-methylcarbamimidoyl)but-2-enimidothioate is sourced from PubChem (CID 143946121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).