C18H21N3O — CID 143950514
2-methyl-1-[3-[[(2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]guanidine (PubChem CID 143950514) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-methyl-1-[3-[[(2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]guanidine.
| Compound Name | 2-methyl-1-[3-[[(2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]guanidine |
|---|---|
| PubChem CID | 143950514 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-methyl-1-[3-[[(2R)-2-methyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]guanidine |
| SMILES | C/N=C(\N)Nc1cccc(OC2c3ccccc3C[C@H]2C)c1 |
| InChI | InChI=1S/C18H21N3O/c1-12-10-13-6-3-4-9-16(13)17(12)22-15-8-5-7-14(11-15)21-18(19)20-2/h3-9,11-12,17H,10H2,1-2H3,(H3,19,20,21)/t12-,17?/m1/s1 |
| InChIKey | RQEAUAJMUMNSOB-MTATWXBHSA-N |
| XLogP | 3.36 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|