C30H40N2O — CID 143950557
(3aR,5S,7aS)-7a-methyl-5-[[(1S,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole (PubChem CID 143950557) has the molecular formula C30H40N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is (3aR,5S,7aS)-7a-methyl-5-[[(1S,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole.
| Compound Name | (3aR,5S,7aS)-7a-methyl-5-[[(1S,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole |
|---|---|
| PubChem CID | 143950557 |
| Molecular Formula | C30H40N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (3aR,5S,7aS)-7a-methyl-5-[[(1S,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole |
| SMILES | C[C@]12CC[C@H](C[C@@H]3Cc4ccccc4[C@H]3Oc3cccc(N4CCCCC4)c3)C[C@H]1CNC2 |
| InChI | InChI=1S/C30H40N2O/c1-30-13-12-22(17-25(30)20-31-21-30)16-24-18-23-8-3-4-11-28(23)29(24)33-27-10-7-9-26(19-27)32-14-5-2-6-15-32/h3-4,7-11,19,22,24-25,29,31H,2,5-6,12-18,20-21H2,1H3/t22-,24-,25+,29+,30-/m1/s1 |
| InChIKey | VEPWSYQFUOMMFE-KAGREDKXSA-N |
| XLogP | 6.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |