C29H40N2O — CID 143950751
[4-[[(1S,2R)-1-[4-(azepan-1-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]methyl]cyclohexyl]methanamine (PubChem CID 143950751) has the molecular formula C29H40N2O and a molecular weight of 432.65 g/mol. Its IUPAC name is [4-[[(1S,2R)-1-[4-(azepan-1-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]methyl]cyclohexyl]methanamine.
| Compound Name | [4-[[(1S,2R)-1-[4-(azepan-1-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 143950751 |
| Molecular Formula | C29H40N2O |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | [4-[[(1S,2R)-1-[4-(azepan-1-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]methyl]cyclohexyl]methanamine |
| SMILES | NCC1CCC(C[C@@H]2Cc3ccccc3[C@H]2Oc2ccc(N3CCCCCC3)cc2)CC1 |
| InChI | InChI=1S/C29H40N2O/c30-21-23-11-9-22(10-12-23)19-25-20-24-7-3-4-8-28(24)29(25)32-27-15-13-26(14-16-27)31-17-5-1-2-6-18-31/h3-4,7-8,13-16,22-23,25,29H,1-2,5-6,9-12,17-21,30H2/t22?,23?,25-,29+/m1/s1 |
| InChIKey | CAVJMYKNAZWEJT-MPFUVBLXSA-N |
| XLogP | 6.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|