C25H30 — CID 143950817
(1R)-1-[[3-[(1Z)-buta-1,3-dienyl]-2,4,6-trimethylphenyl]methyl]-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 143950817) has the molecular formula C25H30 and a molecular weight of 330.52 g/mol. Its IUPAC name is (1R)-1-[[3-[(1Z)-buta-1,3-dienyl]-2,4,6-trimethylphenyl]methyl]-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R)-1-[[3-[(1Z)-buta-1,3-dienyl]-2,4,6-trimethylphenyl]methyl]-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143950817 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (1R)-1-[[3-[(1Z)-buta-1,3-dienyl]-2,4,6-trimethylphenyl]methyl]-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C/C=C\c1c(C)cc(C)c(C[C@H]2c3ccccc3CCC2C)c1C |
| InChI | InChI=1S/C25H30/c1-6-7-11-22-18(3)15-19(4)24(20(22)5)16-25-17(2)13-14-21-10-8-9-12-23(21)25/h6-12,15,17,25H,1,13-14,16H2,2-5H3/b11-7-/t17?,25-/m1/s1 |
| InChIKey | DJNHPKIRYXLQMJ-ROXPVXNKSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|