C14H16O2 — CID 143951365
3-[(1E)-2-ethyl-3-hydroxybuta-1,3-dienyl]-2-methylbenzaldehyde (PubChem CID 143951365) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[(1E)-2-ethyl-3-hydroxybuta-1,3-dienyl]-2-methylbenzaldehyde.
| Compound Name | 3-[(1E)-2-ethyl-3-hydroxybuta-1,3-dienyl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 143951365 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-[(1E)-2-ethyl-3-hydroxybuta-1,3-dienyl]-2-methylbenzaldehyde |
| SMILES | C=C(O)/C(=C/c1cccc(C=O)c1C)CC |
| InChI | InChI=1S/C14H16O2/c1-4-12(11(3)16)8-13-6-5-7-14(9-15)10(13)2/h5-9,16H,3-4H2,1-2H3/b12-8+ |
| InChIKey | CGGWUHZTHRKMFE-XYOKQWHBSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|