C12H11F2NO — CID 143951696
(3E,5Z)-6-amino-3-fluoro-6-(2-fluorophenyl)hexa-3,5-dienal (PubChem CID 143951696) has the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. Its IUPAC name is (3E,5Z)-6-amino-3-fluoro-6-(2-fluorophenyl)hexa-3,5-dienal.
| Compound Name | (3E,5Z)-6-amino-3-fluoro-6-(2-fluorophenyl)hexa-3,5-dienal |
|---|---|
| PubChem CID | 143951696 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (3E,5Z)-6-amino-3-fluoro-6-(2-fluorophenyl)hexa-3,5-dienal |
| SMILES | N/C(=C\C=C(\F)CC=O)c1ccccc1F |
| InChI | InChI=1S/C12H11F2NO/c13-9(7-8-16)5-6-12(15)10-3-1-2-4-11(10)14/h1-6,8H,7,15H2/b9-5+,12-6- |
| InChIKey | ATEQSVVRLTXPOE-DSMXYQKKSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|