C17H16F5N5 — CID 143957660
4-(4-methylpiperazin-1-yl)-8-(1,1,2,2,2-pentafluoroethyl)-3H-pyrazolo[5,4-c]quinoline (PubChem CID 143957660) has the molecular formula C17H16F5N5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-8-(1,1,2,2,2-pentafluoroethyl)-3H-pyrazolo[5,4-c]quinoline.
| Compound Name | 4-(4-methylpiperazin-1-yl)-8-(1,1,2,2,2-pentafluoroethyl)-3H-pyrazolo[5,4-c]quinoline |
|---|---|
| PubChem CID | 143957660 |
| Molecular Formula | C17H16F5N5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-8-(1,1,2,2,2-pentafluoroethyl)-3H-pyrazolo[5,4-c]quinoline |
| SMILES | CN1CCN(c2nc3ccc(C(F)(F)C(F)(F)F)cc3c3cn[nH]c23)CC1 |
| InChI | InChI=1S/C17H16F5N5/c1-26-4-6-27(7-5-26)15-14-12(9-23-25-14)11-8-10(2-3-13(11)24-15)16(18,19)17(20,21)22/h2-3,8-9H,4-7H2,1H3,(H,23,25) |
| InChIKey | VODKIRDKEKRNPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|