C18H15F6N5 — CID 143957737
7-fluoro-5-(4-methylpiperazin-1-yl)-9-(1,1,2,2,2-pentafluoroethyl)pyrazino[2,3-c]quinoline (PubChem CID 143957737) has the molecular formula C18H15F6N5 and a molecular weight of 415.34 g/mol. Its IUPAC name is 7-fluoro-5-(4-methylpiperazin-1-yl)-9-(1,1,2,2,2-pentafluoroethyl)pyrazino[2,3-c]quinoline.
| Compound Name | 7-fluoro-5-(4-methylpiperazin-1-yl)-9-(1,1,2,2,2-pentafluoroethyl)pyrazino[2,3-c]quinoline |
|---|---|
| PubChem CID | 143957737 |
| Molecular Formula | C18H15F6N5 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 7-fluoro-5-(4-methylpiperazin-1-yl)-9-(1,1,2,2,2-pentafluoroethyl)pyrazino[2,3-c]quinoline |
| SMILES | CN1CCN(c2nc3c(F)cc(C(F)(F)C(F)(F)F)cc3c3nccnc23)CC1 |
| InChI | InChI=1S/C18H15F6N5/c1-28-4-6-29(7-5-28)16-15-14(25-2-3-26-15)11-8-10(9-12(19)13(11)27-16)17(20,21)18(22,23)24/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | YVCQXCDFRDBRSJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|