C16H20O4 — CID 143958984
4-[(2E,5E)-8-hydroxy-4-methylocta-2,5-dienoxy]benzoic acid (PubChem CID 143958984) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-[(2E,5E)-8-hydroxy-4-methylocta-2,5-dienoxy]benzoic acid.
| Compound Name | 4-[(2E,5E)-8-hydroxy-4-methylocta-2,5-dienoxy]benzoic acid |
|---|---|
| PubChem CID | 143958984 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[(2E,5E)-8-hydroxy-4-methylocta-2,5-dienoxy]benzoic acid |
| SMILES | CC(/C=C/CCO)/C=C/COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O4/c1-13(5-2-3-11-17)6-4-12-20-15-9-7-14(8-10-15)16(18)19/h2,4-10,13,17H,3,11-12H2,1H3,(H,18,19)/b5-2+,6-4+ |
| InChIKey | FIHBJRKQXPTRFJ-YBSXJGAUSA-N |
| XLogP | 2.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|