C34H47N3O3 — CID 143961007
2-amino-3,5-dimethylphenol;ethane;2-(ethylideneamino)-N-[[4-(3-hexylphenoxy)phenyl]methyl]prop-2-enamide (PubChem CID 143961007) has the molecular formula C34H47N3O3 and a molecular weight of 545.77 g/mol. Its IUPAC name is 2-amino-3,5-dimethylphenol;ethane;2-(ethylideneamino)-N-[[4-(3-hexylphenoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | 2-amino-3,5-dimethylphenol;ethane;2-(ethylideneamino)-N-[[4-(3-hexylphenoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 143961007 |
| Molecular Formula | C34H47N3O3 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | 2-amino-3,5-dimethylphenol;ethane;2-(ethylideneamino)-N-[[4-(3-hexylphenoxy)phenyl]methyl]prop-2-enamide |
| SMILES | C=C(/N=C/C)C(=O)NCc1ccc(Oc2cccc(CCCCCC)c2)cc1.CC.Cc1cc(C)c(N)c(O)c1 |
| InChI | InChI=1S/C24H30N2O2.C8H11NO.C2H6/c1-4-6-7-8-10-20-11-9-12-23(17-20)28-22-15-13-21(14-16-22)18-26-24(27)19(3)25-5-2;1-5-3-6(2)8(9)7(10)4-5;1-2/h5,9,11-17H,3-4,6-8,10,18H2,1-2H3,(H,26,27);3-4,10H,9H2,1-2H3;1-2H3/b25-5+;; |
| InChIKey | CQIRJMLXUDOTEH-XXFPZJQJSA-N |
| XLogP | 8.44 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|