C24H23N3O4 — CID 143962423
2-[(3E,6E)-5-methylidene-7-[4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-nitrohepta-1,3,6-trien-4-yl]oxyethanol (PubChem CID 143962423) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[(3E,6E)-5-methylidene-7-[4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-nitrohepta-1,3,6-trien-4-yl]oxyethanol.
| Compound Name | 2-[(3E,6E)-5-methylidene-7-[4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-nitrohepta-1,3,6-trien-4-yl]oxyethanol |
|---|---|
| PubChem CID | 143962423 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[(3E,6E)-5-methylidene-7-[4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-nitrohepta-1,3,6-trien-4-yl]oxyethanol |
| SMILES | C=C(/C=C/c1ccc(-c2cn3cc(C)ccc3n2)cc1)/C(=C/C(=C)[N+](=O)[O-])OCCO |
| InChI | InChI=1S/C24H23N3O4/c1-17-4-11-24-25-22(16-26(24)15-17)21-9-7-20(8-10-21)6-5-18(2)23(31-13-12-28)14-19(3)27(29)30/h4-11,14-16,28H,2-3,12-13H2,1H3/b6-5+,23-14+ |
| InChIKey | YYBKGNYDNINVAI-LTBXXUSZSA-N |
| XLogP | 4.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|