C18H18ClN3O — CID 135439551
[(E)-1-ethoxy-3-(4-imidazo[1,2-a]pyridin-2-ylphenyl)prop-2-enylidene]azanium chloride (PubChem CID 135439551) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is [(E)-1-ethoxy-3-(4-imidazo[1,2-a]pyridin-2-ylphenyl)prop-2-enylidene]azanium chloride.
| Compound Name | [(E)-1-ethoxy-3-(4-imidazo[1,2-a]pyridin-2-ylphenyl)prop-2-enylidene]azanium chloride |
|---|---|
| PubChem CID | 135439551 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(E)-1-ethoxy-3-(4-imidazo[1,2-a]pyridin-2-ylphenyl)prop-2-enylidene]azanium chloride |
| SMILES | CCOC(=[NH2+])/C=C/c1ccc(-c2cn3ccccc3n2)cc1.[Cl-] |
| InChI | InChI=1S/C18H17N3O.ClH/c1-2-22-17(19)11-8-14-6-9-15(10-7-14)16-13-21-12-4-3-5-18(21)20-16;/h3-13,19H,2H2,1H3;1H/b11-8+,19-17?; |
| InChIKey | PQWLCFGERPCAGK-SXAMJEAXSA-N |
| XLogP | -0.79 |
| TPSA | 52.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|