C12H13FN2 — CID 143963134
(3E,5Z)-6-amino-4-(2-fluorocyclohexa-2,4-dien-1-yl)hexa-3,5-dienenitrile (PubChem CID 143963134) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is (3E,5Z)-6-amino-4-(2-fluorocyclohexa-2,4-dien-1-yl)hexa-3,5-dienenitrile.
| Compound Name | (3E,5Z)-6-amino-4-(2-fluorocyclohexa-2,4-dien-1-yl)hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 143963134 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (3E,5Z)-6-amino-4-(2-fluorocyclohexa-2,4-dien-1-yl)hexa-3,5-dienenitrile |
| SMILES | N#CC/C=C(\C=C/N)C1CC=CC=C1F |
| InChI | InChI=1S/C12H13FN2/c13-12-6-2-1-5-11(12)10(7-9-15)4-3-8-14/h1-2,4,6-7,9,11H,3,5,15H2/b9-7-,10-4+ |
| InChIKey | MFDZGYRPKJJVSD-CLOKBACDSA-N |
| XLogP | 2.73 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|