C13H12F3N3 — CID 143963175
(3E,5Z)-6-amino-4-[2-(trifluoromethyl)anilino]hexa-3,5-dienenitrile (PubChem CID 143963175) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (3E,5Z)-6-amino-4-[2-(trifluoromethyl)anilino]hexa-3,5-dienenitrile.
| Compound Name | (3E,5Z)-6-amino-4-[2-(trifluoromethyl)anilino]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 143963175 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3E,5Z)-6-amino-4-[2-(trifluoromethyl)anilino]hexa-3,5-dienenitrile |
| SMILES | N#CC/C=C(\C=C/N)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3N3/c14-13(15,16)11-5-1-2-6-12(11)19-10(7-9-18)4-3-8-17/h1-2,4-7,9,19H,3,18H2/b9-7-,10-4+ |
| InChIKey | LBNWQLWPBMUYHV-CLOKBACDSA-N |
| XLogP | 3.39 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|