C25H19F3N2O5 — CID 143966336
6-(3-hydroxypropoxy)-N-[4-oxo-2-[3-(trifluoromethyl)phenyl]chromen-8-yl]pyridine-2-carboxamide (PubChem CID 143966336) has the molecular formula C25H19F3N2O5 and a molecular weight of 484.43 g/mol. Its IUPAC name is 6-(3-hydroxypropoxy)-N-[4-oxo-2-[3-(trifluoromethyl)phenyl]chromen-8-yl]pyridine-2-carboxamide.
| Compound Name | 6-(3-hydroxypropoxy)-N-[4-oxo-2-[3-(trifluoromethyl)phenyl]chromen-8-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143966336 |
| Molecular Formula | C25H19F3N2O5 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 6-(3-hydroxypropoxy)-N-[4-oxo-2-[3-(trifluoromethyl)phenyl]chromen-8-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc2c(=O)cc(-c3cccc(C(F)(F)F)c3)oc12)c1cccc(OCCCO)n1 |
| InChI | InChI=1S/C25H19F3N2O5/c26-25(27,28)16-6-1-5-15(13-16)21-14-20(32)17-7-2-8-18(23(17)35-21)30-24(33)19-9-3-10-22(29-19)34-12-4-11-31/h1-3,5-10,13-14,31H,4,11-12H2,(H,30,33) |
| InChIKey | ZEAGBBJMFLYKOF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|